C14H23N3O — CID 62167745
2-(ethylamino)-N,N-dipropylpyridine-4-carboxamide (PubChem CID 62167745) has the molecular formula C14H23N3O and a molecular weight of 249.36 g/mol. Its IUPAC name is 2-(ethylamino)-N,N-dipropylpyridine-4-carboxamide.
| Compound Name | 2-(ethylamino)-N,N-dipropylpyridine-4-carboxamide |
|---|---|
| PubChem CID | 62167745 |
| Molecular Formula | C14H23N3O |
| Molecular Weight | 249.36 g/mol |
| Exact Mass | 249.18 |
| IUPAC Name | 2-(ethylamino)-N,N-dipropylpyridine-4-carboxamide |
| SMILES | CCCN(CCC)C(=O)c1ccnc(NCC)c1 |
| InChI | InChI=1S/C14H23N3O/c1-4-9-17(10-5-2)14(18)12-7-8-16-13(11-12)15-6-3/h7-8,11H,4-6,9-10H2,1-3H3,(H,15,16) |
| InChIKey | PWASTBTXOFZKOF-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.36 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |