C30H25P5 — CID 621704
1,2,3,4,5-pentakis-phenylpentaphospholane (PubChem CID 621704) has the molecular formula C30H25P5 and a molecular weight of 540.40 g/mol. Its IUPAC name is 1,2,3,4,5-pentakis-phenylpentaphospholane.
| Compound Name | 1,2,3,4,5-pentakis-phenylpentaphospholane |
|---|---|
| PubChem CID | 621704 |
| Molecular Formula | C30H25P5 |
| Molecular Weight | 540.40 g/mol |
| Exact Mass | 540.06 |
| IUPAC Name | 1,2,3,4,5-pentakis-phenylpentaphospholane |
| SMILES | c1ccc(-p2p(-c3ccccc3)p(-c3ccccc3)p(-c3ccccc3)p2-c2ccccc2)cc1 |
| InChI | InChI=1S/C30H25P5/c1-6-16-26(17-7-1)31-32(27-18-8-2-9-19-27)34(29-22-12-4-13-23-29)35(30-24-14-5-15-25-30)33(31)28-20-10-3-11-21-28/h1-25H |
| InChIKey | ZWRMRAPCUFXCEQ-UHFFFAOYSA-N |
| XLogP | 12.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.40 |
| LogP ≤ 5 | 12.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |