About 2-chloro-5-[(2Z)-2-(3,4-dihydro-2H-naphthalen-1-ylidene)hydrazinyl]benzoic acid
2-chloro-5-[(2Z)-2-(3,4-dihydro-2H-naphthalen-1-ylidene)hydrazinyl]benzoic acid (PubChem CID 6217133) has the molecular formula C17H15ClN2O2
and a molecular weight of 314.77 g/mol. Its IUPAC name is 2-chloro-5-[(2Z)-2-(3,4-dihydro-2H-naphthalen-1-ylidene)hydrazinyl]benzoic acid.
Molecular Properties
| Compound Name | 2-chloro-5-[(2Z)-2-(3,4-dihydro-2H-naphthalen-1-ylidene)hydrazinyl]benzoic acid |
| PubChem CID | 6217133 |
| Molecular Formula | C17H15ClN2O2 |
| Molecular Weight | 314.77 g/mol |
| Exact Mass | 314.08 |
| IUPAC Name | 2-chloro-5-[(2Z)-2-(3,4-dihydro-2H-naphthalen-1-ylidene)hydrazinyl]benzoic acid |
| SMILES | O=C(O)c1cc(N/N=C2/CCCc3ccccc32)ccc1Cl |
| InChI | InChI=1S/C17H15ClN2O2/c18-15-9-8-12(10-14(15)17(21)22)19-20-16-7-3-5-11-4-1-2-6-13(11)16/h1-2,4,6,8-10,19H,3,5,7H2,(H,21,22)/b20-16- |
| InChIKey | FMRCQYAPKHOKTI-SILNSSARSA-N |
| XLogP | 4.19 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.77 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-5-[(2Z)-2-(3,4-dihydro-2H-naphthalen-1-ylidene)hydrazinyl]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-5-[(2Z)-2-(3,4-dihydro-2H-naphthalen-1-ylidene)hydrazinyl]benzoic acid?
The IUPAC name of 2-chloro-5-[(2Z)-2-(3,4-dihydro-2H-naphthalen-1-ylidene)hydrazinyl]benzoic acid (CID 6217133) is 2-chloro-5-[(2Z)-2-(3,4-dihydro-2H-naphthalen-1-ylidene)hydrazinyl]benzoic acid.
What is the SMILES notation for 2-chloro-5-[(2Z)-2-(3,4-dihydro-2H-naphthalen-1-ylidene)hydrazinyl]benzoic acid?
The canonical SMILES for 2-chloro-5-[(2Z)-2-(3,4-dihydro-2H-naphthalen-1-ylidene)hydrazinyl]benzoic acid is O=C(O)c1cc(N/N=C2/CCCc3ccccc32)ccc1Cl.
What is the InChIKey of 2-chloro-5-[(2Z)-2-(3,4-dihydro-2H-naphthalen-1-ylidene)hydrazinyl]benzoic acid?
The InChIKey is FMRCQYAPKHOKTI-SILNSSARSA-N. The full InChI is InChI=1S/C17H15ClN2O2/c18-15-9-8-12(10-14(15)17(21)22)19-20-16-7-3-5-11-4-1-2-6-13(11)16/h1-2,4,6,8-10,19H,3,5,7H2,(H,21,22)/b20-16-.
What are the key properties of 2-chloro-5-[(2Z)-2-(3,4-dihydro-2H-naphthalen-1-ylidene)hydrazinyl]benzoic acid?
2-chloro-5-[(2Z)-2-(3,4-dihydro-2H-naphthalen-1-ylidene)hydrazinyl]benzoic acid has a molecular weight of 314.77 g/mol, XLogP of 4.19, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-5-[(2Z)-2-(3,4-dihydro-2H-naphthalen-1-ylidene)hydrazinyl]benzoic acid is sourced from PubChem (CID 6217133), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).