C14H20ClN3O — CID 62172223
[5-chloro-6-(ethylamino)-3-pyridinyl]-(3-methylpiperidin-1-yl)methanone (PubChem CID 62172223) has the molecular formula C14H20ClN3O and a molecular weight of 281.79 g/mol. Its IUPAC name is [5-chloro-6-(ethylamino)-3-pyridinyl]-(3-methylpiperidin-1-yl)methanone.
| Compound Name | [5-chloro-6-(ethylamino)-3-pyridinyl]-(3-methylpiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 62172223 |
| Molecular Formula | C14H20ClN3O |
| Molecular Weight | 281.79 g/mol |
| Exact Mass | 281.13 |
| IUPAC Name | [5-chloro-6-(ethylamino)-3-pyridinyl]-(3-methylpiperidin-1-yl)methanone |
| SMILES | CCNc1ncc(C(=O)N2CCCC(C)C2)cc1Cl |
| InChI | InChI=1S/C14H20ClN3O/c1-3-16-13-12(15)7-11(8-17-13)14(19)18-6-4-5-10(2)9-18/h7-8,10H,3-6,9H2,1-2H3,(H,16,17) |
| InChIKey | ZGGGBASBMBXGEC-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.79 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |