C13H18ClN3O3 — CID 62173035
3-chloro-4-(methylamino)-N-(2-methylbutan-2-yl)-5-nitrobenzamide (PubChem CID 62173035) has the molecular formula C13H18ClN3O3 and a molecular weight of 299.76 g/mol. Its IUPAC name is 3-chloro-4-(methylamino)-N-(2-methylbutan-2-yl)-5-nitrobenzamide.
| Compound Name | 3-chloro-4-(methylamino)-N-(2-methylbutan-2-yl)-5-nitrobenzamide |
|---|---|
| PubChem CID | 62173035 |
| Molecular Formula | C13H18ClN3O3 |
| Molecular Weight | 299.76 g/mol |
| Exact Mass | 299.10 |
| IUPAC Name | 3-chloro-4-(methylamino)-N-(2-methylbutan-2-yl)-5-nitrobenzamide |
| SMILES | CCC(C)(C)NC(=O)c1cc(Cl)c(NC)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H18ClN3O3/c1-5-13(2,3)16-12(18)8-6-9(14)11(15-4)10(7-8)17(19)20/h6-7,15H,5H2,1-4H3,(H,16,18) |
| InChIKey | BMXKBHSKMMVVAH-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 84.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.76 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|