C15H18O4 — CID 621732
3-methyl-6-propan-2-yl-3,5,6,7-tetrahydro-2H-furo[3,2-g]chromene-4,9-dione (PubChem CID 621732) has the molecular formula C15H18O4 and a molecular weight of 262.30 g/mol. Its IUPAC name is 3-methyl-6-propan-2-yl-3,5,6,7-tetrahydro-2H-furo[3,2-g]chromene-4,9-dione.
| Compound Name | 3-methyl-6-propan-2-yl-3,5,6,7-tetrahydro-2H-furo[3,2-g]chromene-4,9-dione |
|---|---|
| PubChem CID | 621732 |
| Molecular Formula | C15H18O4 |
| Molecular Weight | 262.30 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | 3-methyl-6-propan-2-yl-3,5,6,7-tetrahydro-2H-furo[3,2-g]chromene-4,9-dione |
| SMILES | CC1COC2=C1C(=O)C1=C(OCC(C(C)C)C1)C2=O |
| InChI | InChI=1S/C15H18O4/c1-7(2)9-4-10-12(16)11-8(3)5-18-15(11)13(17)14(10)19-6-9/h7-9H,4-6H2,1-3H3 |
| InChIKey | FCVVXPCXLOPFAF-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.30 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|