C12H19N3O2 — CID 62174214
N-(1-ethoxypropan-2-yl)-2-(methylamino)pyridine-3-carboxamide (PubChem CID 62174214) has the molecular formula C12H19N3O2 and a molecular weight of 237.30 g/mol. Its IUPAC name is N-(1-ethoxypropan-2-yl)-2-(methylamino)pyridine-3-carboxamide.
| Compound Name | N-(1-ethoxypropan-2-yl)-2-(methylamino)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 62174214 |
| Molecular Formula | C12H19N3O2 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.15 |
| IUPAC Name | N-(1-ethoxypropan-2-yl)-2-(methylamino)pyridine-3-carboxamide |
| SMILES | CCOCC(C)NC(=O)c1cccnc1NC |
| InChI | InChI=1S/C12H19N3O2/c1-4-17-8-9(2)15-12(16)10-6-5-7-14-11(10)13-3/h5-7,9H,4,8H2,1-3H3,(H,13,14)(H,15,16) |
| InChIKey | VJPVLCBHRCCJEI-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |