C14H24N4O3 — CID 62176695
N,N-bis(2-methoxyethyl)-6-(propylamino)pyridazine-3-carboxamide (PubChem CID 62176695) has the molecular formula C14H24N4O3 and a molecular weight of 296.37 g/mol. Its IUPAC name is N,N-bis(2-methoxyethyl)-6-(propylamino)pyridazine-3-carboxamide.
| Compound Name | N,N-bis(2-methoxyethyl)-6-(propylamino)pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 62176695 |
| Molecular Formula | C14H24N4O3 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.18 |
| IUPAC Name | N,N-bis(2-methoxyethyl)-6-(propylamino)pyridazine-3-carboxamide |
| SMILES | CCCNc1ccc(C(=O)N(CCOC)CCOC)nn1 |
| InChI | InChI=1S/C14H24N4O3/c1-4-7-15-13-6-5-12(16-17-13)14(19)18(8-10-20-2)9-11-21-3/h5-6H,4,7-11H2,1-3H3,(H,15,17) |
| InChIKey | USQINRLMONQEBZ-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |