C16H25ClN2O — CID 62177319
N-butan-2-yl-N-butyl-5-chloro-2-(methylamino)benzamide (PubChem CID 62177319) has the molecular formula C16H25ClN2O and a molecular weight of 296.84 g/mol. Its IUPAC name is N-butan-2-yl-N-butyl-5-chloro-2-(methylamino)benzamide.
| Compound Name | N-butan-2-yl-N-butyl-5-chloro-2-(methylamino)benzamide |
|---|---|
| PubChem CID | 62177319 |
| Molecular Formula | C16H25ClN2O |
| Molecular Weight | 296.84 g/mol |
| Exact Mass | 296.17 |
| IUPAC Name | N-butan-2-yl-N-butyl-5-chloro-2-(methylamino)benzamide |
| SMILES | CCCCN(C(=O)c1cc(Cl)ccc1NC)C(C)CC |
| InChI | InChI=1S/C16H25ClN2O/c1-5-7-10-19(12(3)6-2)16(20)14-11-13(17)8-9-15(14)18-4/h8-9,11-12,18H,5-7,10H2,1-4H3 |
| InChIKey | CXFOBJJGUNQUOC-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.84 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |