About 3-chloro-N-(1,4-dioxan-2-ylmethyl)-6-(propylamino)pyridine-2-carboxamide
3-chloro-N-(1,4-dioxan-2-ylmethyl)-6-(propylamino)pyridine-2-carboxamide (PubChem CID 62179373) has the molecular formula C14H20ClN3O3
and a molecular weight of 313.79 g/mol. Its IUPAC name is 3-chloro-N-(1,4-dioxan-2-ylmethyl)-6-(propylamino)pyridine-2-carboxamide.
Molecular Properties
| Compound Name | 3-chloro-N-(1,4-dioxan-2-ylmethyl)-6-(propylamino)pyridine-2-carboxamide |
| PubChem CID | 62179373 |
| Molecular Formula | C14H20ClN3O3 |
| Molecular Weight | 313.79 g/mol |
| Exact Mass | 313.12 |
| IUPAC Name | 3-chloro-N-(1,4-dioxan-2-ylmethyl)-6-(propylamino)pyridine-2-carboxamide |
| SMILES | CCCNc1ccc(Cl)c(C(=O)NCC2COCCO2)n1 |
| InChI | InChI=1S/C14H20ClN3O3/c1-2-5-16-12-4-3-11(15)13(18-12)14(19)17-8-10-9-20-6-7-21-10/h3-4,10H,2,5-9H2,1H3,(H,16,18)(H,17,19) |
| InChIKey | PJFJPIHHSSURHJ-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.79 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-chloro-N-(1,4-dioxan-2-ylmethyl)-6-(propylamino)pyridine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-N-(1,4-dioxan-2-ylmethyl)-6-(propylamino)pyridine-2-carboxamide?
The IUPAC name of 3-chloro-N-(1,4-dioxan-2-ylmethyl)-6-(propylamino)pyridine-2-carboxamide (CID 62179373) is 3-chloro-N-(1,4-dioxan-2-ylmethyl)-6-(propylamino)pyridine-2-carboxamide.
What is the SMILES notation for 3-chloro-N-(1,4-dioxan-2-ylmethyl)-6-(propylamino)pyridine-2-carboxamide?
The canonical SMILES for 3-chloro-N-(1,4-dioxan-2-ylmethyl)-6-(propylamino)pyridine-2-carboxamide is CCCNc1ccc(Cl)c(C(=O)NCC2COCCO2)n1.
What is the InChIKey of 3-chloro-N-(1,4-dioxan-2-ylmethyl)-6-(propylamino)pyridine-2-carboxamide?
The InChIKey is PJFJPIHHSSURHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20ClN3O3/c1-2-5-16-12-4-3-11(15)13(18-12)14(19)17-8-10-9-20-6-7-21-10/h3-4,10H,2,5-9H2,1H3,(H,16,18)(H,17,19).
What are the key properties of 3-chloro-N-(1,4-dioxan-2-ylmethyl)-6-(propylamino)pyridine-2-carboxamide?
3-chloro-N-(1,4-dioxan-2-ylmethyl)-6-(propylamino)pyridine-2-carboxamide has a molecular weight of 313.79 g/mol, XLogP of 1.70, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-N-(1,4-dioxan-2-ylmethyl)-6-(propylamino)pyridine-2-carboxamide is sourced from PubChem (CID 62179373), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).