C15H22BrN3O2 — CID 62179962
5-bromo-N-ethyl-2-(ethylamino)-N-(oxolan-2-ylmethyl)pyridine-3-carboxamide (PubChem CID 62179962) has the molecular formula C15H22BrN3O2 and a molecular weight of 356.26 g/mol. Its IUPAC name is 5-bromo-N-ethyl-2-(ethylamino)-N-(oxolan-2-ylmethyl)pyridine-3-carboxamide.
| Compound Name | 5-bromo-N-ethyl-2-(ethylamino)-N-(oxolan-2-ylmethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 62179962 |
| Molecular Formula | C15H22BrN3O2 |
| Molecular Weight | 356.26 g/mol |
| Exact Mass | 355.09 |
| IUPAC Name | 5-bromo-N-ethyl-2-(ethylamino)-N-(oxolan-2-ylmethyl)pyridine-3-carboxamide |
| SMILES | CCNc1ncc(Br)cc1C(=O)N(CC)CC1CCCO1 |
| InChI | InChI=1S/C15H22BrN3O2/c1-3-17-14-13(8-11(16)9-18-14)15(20)19(4-2)10-12-6-5-7-21-12/h8-9,12H,3-7,10H2,1-2H3,(H,17,18) |
| InChIKey | NSAOARWRRSVBBC-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.26 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |