C12H11BrN4O3S — CID 62180552
N-(5-bromo-1,3-thiazol-2-yl)-4-(ethylamino)-3-nitrobenzamide (PubChem CID 62180552) has the molecular formula C12H11BrN4O3S and a molecular weight of 371.22 g/mol. Its IUPAC name is N-(5-bromo-1,3-thiazol-2-yl)-4-(ethylamino)-3-nitrobenzamide.
| Compound Name | N-(5-bromo-1,3-thiazol-2-yl)-4-(ethylamino)-3-nitrobenzamide |
|---|---|
| PubChem CID | 62180552 |
| Molecular Formula | C12H11BrN4O3S |
| Molecular Weight | 371.22 g/mol |
| Exact Mass | 369.97 |
| IUPAC Name | N-(5-bromo-1,3-thiazol-2-yl)-4-(ethylamino)-3-nitrobenzamide |
| SMILES | CCNc1ccc(C(=O)Nc2ncc(Br)s2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H11BrN4O3S/c1-2-14-8-4-3-7(5-9(8)17(19)20)11(18)16-12-15-6-10(13)21-12/h3-6,14H,2H2,1H3,(H,15,16,18) |
| InChIKey | FWMCYNXKFGRLSH-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 97.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.22 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|