C13H20N4O2 — CID 62181516
6-(ethylamino)-N-(oxan-2-ylmethyl)pyridazine-3-carboxamide (PubChem CID 62181516) has the molecular formula C13H20N4O2 and a molecular weight of 264.33 g/mol. Its IUPAC name is 6-(ethylamino)-N-(oxan-2-ylmethyl)pyridazine-3-carboxamide.
| Compound Name | 6-(ethylamino)-N-(oxan-2-ylmethyl)pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 62181516 |
| Molecular Formula | C13H20N4O2 |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 264.16 |
| IUPAC Name | 6-(ethylamino)-N-(oxan-2-ylmethyl)pyridazine-3-carboxamide |
| SMILES | CCNc1ccc(C(=O)NCC2CCCCO2)nn1 |
| InChI | InChI=1S/C13H20N4O2/c1-2-14-12-7-6-11(16-17-12)13(18)15-9-10-5-3-4-8-19-10/h6-7,10H,2-5,8-9H2,1H3,(H,14,17)(H,15,18) |
| InChIKey | YNEDSLWMJNESMF-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |