About N-methyl-4-[(1-oxo-1,4-thiazinan-4-yl)methyl]thiadiazol-5-amine
N-methyl-4-[(1-oxo-1,4-thiazinan-4-yl)methyl]thiadiazol-5-amine (PubChem CID 62182140) has the molecular formula C8H14N4OS2
and a molecular weight of 246.36 g/mol. Its IUPAC name is N-methyl-4-[(1-oxo-1,4-thiazinan-4-yl)methyl]thiadiazol-5-amine.
Molecular Properties
| Compound Name | N-methyl-4-[(1-oxo-1,4-thiazinan-4-yl)methyl]thiadiazol-5-amine |
| PubChem CID | 62182140 |
| Molecular Formula | C8H14N4OS2 |
| Molecular Weight | 246.36 g/mol |
| Exact Mass | 246.06 |
| IUPAC Name | N-methyl-4-[(1-oxo-1,4-thiazinan-4-yl)methyl]thiadiazol-5-amine |
| SMILES | CNc1snnc1CN1CCS(=O)CC1 |
| InChI | InChI=1S/C8H14N4OS2/c1-9-8-7(10-11-14-8)6-12-2-4-15(13)5-3-12/h9H,2-6H2,1H3 |
| InChIKey | WAGBTOGVXJTATG-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.36 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-methyl-4-[(1-oxo-1,4-thiazinan-4-yl)methyl]thiadiazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-4-[(1-oxo-1,4-thiazinan-4-yl)methyl]thiadiazol-5-amine?
The IUPAC name of N-methyl-4-[(1-oxo-1,4-thiazinan-4-yl)methyl]thiadiazol-5-amine (CID 62182140) is N-methyl-4-[(1-oxo-1,4-thiazinan-4-yl)methyl]thiadiazol-5-amine.
What is the SMILES notation for N-methyl-4-[(1-oxo-1,4-thiazinan-4-yl)methyl]thiadiazol-5-amine?
The canonical SMILES for N-methyl-4-[(1-oxo-1,4-thiazinan-4-yl)methyl]thiadiazol-5-amine is CNc1snnc1CN1CCS(=O)CC1.
What is the InChIKey of N-methyl-4-[(1-oxo-1,4-thiazinan-4-yl)methyl]thiadiazol-5-amine?
The InChIKey is WAGBTOGVXJTATG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N4OS2/c1-9-8-7(10-11-14-8)6-12-2-4-15(13)5-3-12/h9H,2-6H2,1H3.
What are the key properties of N-methyl-4-[(1-oxo-1,4-thiazinan-4-yl)methyl]thiadiazol-5-amine?
N-methyl-4-[(1-oxo-1,4-thiazinan-4-yl)methyl]thiadiazol-5-amine has a molecular weight of 246.36 g/mol, XLogP of 0.14, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-4-[(1-oxo-1,4-thiazinan-4-yl)methyl]thiadiazol-5-amine is sourced from PubChem (CID 62182140), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).