C16H24N4S — CID 62182349
2-(azocan-1-ylmethyl)-N-ethylthieno[2,3-d]pyrimidin-4-amine (PubChem CID 62182349) has the molecular formula C16H24N4S and a molecular weight of 304.46 g/mol. Its IUPAC name is 2-(azocan-1-ylmethyl)-N-ethylthieno[2,3-d]pyrimidin-4-amine.
| Compound Name | 2-(azocan-1-ylmethyl)-N-ethylthieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 62182349 |
| Molecular Formula | C16H24N4S |
| Molecular Weight | 304.46 g/mol |
| Exact Mass | 304.17 |
| IUPAC Name | 2-(azocan-1-ylmethyl)-N-ethylthieno[2,3-d]pyrimidin-4-amine |
| SMILES | CCNc1nc(CN2CCCCCCC2)nc2sccc12 |
| InChI | InChI=1S/C16H24N4S/c1-2-17-15-13-8-11-21-16(13)19-14(18-15)12-20-9-6-4-3-5-7-10-20/h8,11H,2-7,9-10,12H2,1H3,(H,17,18,19) |
| InChIKey | BIMRONPLHITOSS-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.46 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |