About 2-[(4-aminothieno[2,3-d]pyrimidin-2-yl)methyl-(2-methylpropyl)amino]acetamide
2-[(4-aminothieno[2,3-d]pyrimidin-2-yl)methyl-(2-methylpropyl)amino]acetamide (PubChem CID 62182664) has the molecular formula C13H19N5OS
and a molecular weight of 293.40 g/mol. Its IUPAC name is 2-[(4-aminothieno[2,3-d]pyrimidin-2-yl)methyl-(2-methylpropyl)amino]acetamide.
Molecular Properties
| Compound Name | 2-[(4-aminothieno[2,3-d]pyrimidin-2-yl)methyl-(2-methylpropyl)amino]acetamide |
| PubChem CID | 62182664 |
| Molecular Formula | C13H19N5OS |
| Molecular Weight | 293.40 g/mol |
| Exact Mass | 293.13 |
| IUPAC Name | 2-[(4-aminothieno[2,3-d]pyrimidin-2-yl)methyl-(2-methylpropyl)amino]acetamide |
| SMILES | CC(C)CN(CC(N)=O)Cc1nc(N)c2ccsc2n1 |
| InChI | InChI=1S/C13H19N5OS/c1-8(2)5-18(6-10(14)19)7-11-16-12(15)9-3-4-20-13(9)17-11/h3-4,8H,5-7H2,1-2H3,(H2,14,19)(H2,15,16,17) |
| InChIKey | LCHVAAXNIBSAJT-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 98.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.40 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[(4-aminothieno[2,3-d]pyrimidin-2-yl)methyl-(2-methylpropyl)amino]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4-aminothieno[2,3-d]pyrimidin-2-yl)methyl-(2-methylpropyl)amino]acetamide?
The IUPAC name of 2-[(4-aminothieno[2,3-d]pyrimidin-2-yl)methyl-(2-methylpropyl)amino]acetamide (CID 62182664) is 2-[(4-aminothieno[2,3-d]pyrimidin-2-yl)methyl-(2-methylpropyl)amino]acetamide.
What is the SMILES notation for 2-[(4-aminothieno[2,3-d]pyrimidin-2-yl)methyl-(2-methylpropyl)amino]acetamide?
The canonical SMILES for 2-[(4-aminothieno[2,3-d]pyrimidin-2-yl)methyl-(2-methylpropyl)amino]acetamide is CC(C)CN(CC(N)=O)Cc1nc(N)c2ccsc2n1.
What is the InChIKey of 2-[(4-aminothieno[2,3-d]pyrimidin-2-yl)methyl-(2-methylpropyl)amino]acetamide?
The InChIKey is LCHVAAXNIBSAJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19N5OS/c1-8(2)5-18(6-10(14)19)7-11-16-12(15)9-3-4-20-13(9)17-11/h3-4,8H,5-7H2,1-2H3,(H2,14,19)(H2,15,16,17).
What are the key properties of 2-[(4-aminothieno[2,3-d]pyrimidin-2-yl)methyl-(2-methylpropyl)amino]acetamide?
2-[(4-aminothieno[2,3-d]pyrimidin-2-yl)methyl-(2-methylpropyl)amino]acetamide has a molecular weight of 293.40 g/mol, XLogP of 1.22, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4-aminothieno[2,3-d]pyrimidin-2-yl)methyl-(2-methylpropyl)amino]acetamide is sourced from PubChem (CID 62182664), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).