About 4-[[ethyl(2,2,2-trifluoroethyl)amino]methyl]-N-methylthiadiazol-5-amine
4-[[ethyl(2,2,2-trifluoroethyl)amino]methyl]-N-methylthiadiazol-5-amine (PubChem CID 62184386) has the molecular formula C8H13F3N4S
and a molecular weight of 254.28 g/mol. Its IUPAC name is 4-[[ethyl(2,2,2-trifluoroethyl)amino]methyl]-N-methylthiadiazol-5-amine.
Molecular Properties
| Compound Name | 4-[[ethyl(2,2,2-trifluoroethyl)amino]methyl]-N-methylthiadiazol-5-amine |
| PubChem CID | 62184386 |
| Molecular Formula | C8H13F3N4S |
| Molecular Weight | 254.28 g/mol |
| Exact Mass | 254.08 |
| IUPAC Name | 4-[[ethyl(2,2,2-trifluoroethyl)amino]methyl]-N-methylthiadiazol-5-amine |
| SMILES | CCN(Cc1nnsc1NC)CC(F)(F)F |
| InChI | InChI=1S/C8H13F3N4S/c1-3-15(5-8(9,10)11)4-6-7(12-2)16-14-13-6/h12H,3-5H2,1-2H3 |
| InChIKey | JBEQSRBBNAVYDZ-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.28 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[[ethyl(2,2,2-trifluoroethyl)amino]methyl]-N-methylthiadiazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[ethyl(2,2,2-trifluoroethyl)amino]methyl]-N-methylthiadiazol-5-amine?
The IUPAC name of 4-[[ethyl(2,2,2-trifluoroethyl)amino]methyl]-N-methylthiadiazol-5-amine (CID 62184386) is 4-[[ethyl(2,2,2-trifluoroethyl)amino]methyl]-N-methylthiadiazol-5-amine.
What is the SMILES notation for 4-[[ethyl(2,2,2-trifluoroethyl)amino]methyl]-N-methylthiadiazol-5-amine?
The canonical SMILES for 4-[[ethyl(2,2,2-trifluoroethyl)amino]methyl]-N-methylthiadiazol-5-amine is CCN(Cc1nnsc1NC)CC(F)(F)F.
What is the InChIKey of 4-[[ethyl(2,2,2-trifluoroethyl)amino]methyl]-N-methylthiadiazol-5-amine?
The InChIKey is JBEQSRBBNAVYDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13F3N4S/c1-3-15(5-8(9,10)11)4-6-7(12-2)16-14-13-6/h12H,3-5H2,1-2H3.
What are the key properties of 4-[[ethyl(2,2,2-trifluoroethyl)amino]methyl]-N-methylthiadiazol-5-amine?
4-[[ethyl(2,2,2-trifluoroethyl)amino]methyl]-N-methylthiadiazol-5-amine has a molecular weight of 254.28 g/mol, XLogP of 1.96, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[ethyl(2,2,2-trifluoroethyl)amino]methyl]-N-methylthiadiazol-5-amine is sourced from PubChem (CID 62184386), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).