C15H15Cl2N3O — CID 62186931
N-(2,4-dichlorophenyl)-2-(propylamino)pyridine-4-carboxamide (PubChem CID 62186931) has the molecular formula C15H15Cl2N3O and a molecular weight of 324.21 g/mol. Its IUPAC name is N-(2,4-dichlorophenyl)-2-(propylamino)pyridine-4-carboxamide.
| Compound Name | N-(2,4-dichlorophenyl)-2-(propylamino)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 62186931 |
| Molecular Formula | C15H15Cl2N3O |
| Molecular Weight | 324.21 g/mol |
| Exact Mass | 323.06 |
| IUPAC Name | N-(2,4-dichlorophenyl)-2-(propylamino)pyridine-4-carboxamide |
| SMILES | CCCNc1cc(C(=O)Nc2ccc(Cl)cc2Cl)ccn1 |
| InChI | InChI=1S/C15H15Cl2N3O/c1-2-6-18-14-8-10(5-7-19-14)15(21)20-13-4-3-11(16)9-12(13)17/h3-5,7-9H,2,6H2,1H3,(H,18,19)(H,20,21) |
| InChIKey | JWUCXEFDEKWVAM-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.21 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |