C13H11BrClN3O2 — CID 62187028
2-amino-N-(5-bromo-2-methoxyphenyl)-6-chloropyridine-4-carboxamide (PubChem CID 62187028) has the molecular formula C13H11BrClN3O2 and a molecular weight of 356.61 g/mol. Its IUPAC name is 2-amino-N-(5-bromo-2-methoxyphenyl)-6-chloropyridine-4-carboxamide.
| Compound Name | 2-amino-N-(5-bromo-2-methoxyphenyl)-6-chloropyridine-4-carboxamide |
|---|---|
| PubChem CID | 62187028 |
| Molecular Formula | C13H11BrClN3O2 |
| Molecular Weight | 356.61 g/mol |
| Exact Mass | 354.97 |
| IUPAC Name | 2-amino-N-(5-bromo-2-methoxyphenyl)-6-chloropyridine-4-carboxamide |
| SMILES | COc1ccc(Br)cc1NC(=O)c1cc(N)nc(Cl)c1 |
| InChI | InChI=1S/C13H11BrClN3O2/c1-20-10-3-2-8(14)6-9(10)17-13(19)7-4-11(15)18-12(16)5-7/h2-6H,1H3,(H2,16,18)(H,17,19) |
| InChIKey | RNORIAGJVGFWFH-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.61 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|