About 2-[(4-chlorothieno[2,3-d]pyrimidin-2-yl)methyl-propan-2-ylamino]acetamide
2-[(4-chlorothieno[2,3-d]pyrimidin-2-yl)methyl-propan-2-ylamino]acetamide (PubChem CID 62187940) has the molecular formula C12H15ClN4OS
and a molecular weight of 298.80 g/mol. Its IUPAC name is 2-[(4-chlorothieno[2,3-d]pyrimidin-2-yl)methyl-propan-2-ylamino]acetamide.
Molecular Properties
| Compound Name | 2-[(4-chlorothieno[2,3-d]pyrimidin-2-yl)methyl-propan-2-ylamino]acetamide |
| PubChem CID | 62187940 |
| Molecular Formula | C12H15ClN4OS |
| Molecular Weight | 298.80 g/mol |
| Exact Mass | 298.07 |
| IUPAC Name | 2-[(4-chlorothieno[2,3-d]pyrimidin-2-yl)methyl-propan-2-ylamino]acetamide |
| SMILES | CC(C)N(CC(N)=O)Cc1nc(Cl)c2ccsc2n1 |
| InChI | InChI=1S/C12H15ClN4OS/c1-7(2)17(5-9(14)18)6-10-15-11(13)8-3-4-19-12(8)16-10/h3-4,7H,5-6H2,1-2H3,(H2,14,18) |
| InChIKey | SDCNZCKNJJHOKU-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 72.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.80 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[(4-chlorothieno[2,3-d]pyrimidin-2-yl)methyl-propan-2-ylamino]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4-chlorothieno[2,3-d]pyrimidin-2-yl)methyl-propan-2-ylamino]acetamide?
The IUPAC name of 2-[(4-chlorothieno[2,3-d]pyrimidin-2-yl)methyl-propan-2-ylamino]acetamide (CID 62187940) is 2-[(4-chlorothieno[2,3-d]pyrimidin-2-yl)methyl-propan-2-ylamino]acetamide.
What is the SMILES notation for 2-[(4-chlorothieno[2,3-d]pyrimidin-2-yl)methyl-propan-2-ylamino]acetamide?
The canonical SMILES for 2-[(4-chlorothieno[2,3-d]pyrimidin-2-yl)methyl-propan-2-ylamino]acetamide is CC(C)N(CC(N)=O)Cc1nc(Cl)c2ccsc2n1.
What is the InChIKey of 2-[(4-chlorothieno[2,3-d]pyrimidin-2-yl)methyl-propan-2-ylamino]acetamide?
The InChIKey is SDCNZCKNJJHOKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15ClN4OS/c1-7(2)17(5-9(14)18)6-10-15-11(13)8-3-4-19-12(8)16-10/h3-4,7H,5-6H2,1-2H3,(H2,14,18).
What are the key properties of 2-[(4-chlorothieno[2,3-d]pyrimidin-2-yl)methyl-propan-2-ylamino]acetamide?
2-[(4-chlorothieno[2,3-d]pyrimidin-2-yl)methyl-propan-2-ylamino]acetamide has a molecular weight of 298.80 g/mol, XLogP of 2.04, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4-chlorothieno[2,3-d]pyrimidin-2-yl)methyl-propan-2-ylamino]acetamide is sourced from PubChem (CID 62187940), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).