About N-methyl-5-(1,3,4-thiadiazol-2-ylsulfanylmethyl)pyridin-2-amine
N-methyl-5-(1,3,4-thiadiazol-2-ylsulfanylmethyl)pyridin-2-amine (PubChem CID 62188235) has the molecular formula C9H10N4S2
and a molecular weight of 238.34 g/mol. Its IUPAC name is N-methyl-5-(1,3,4-thiadiazol-2-ylsulfanylmethyl)pyridin-2-amine.
Molecular Properties
| Compound Name | N-methyl-5-(1,3,4-thiadiazol-2-ylsulfanylmethyl)pyridin-2-amine |
| PubChem CID | 62188235 |
| Molecular Formula | C9H10N4S2 |
| Molecular Weight | 238.34 g/mol |
| Exact Mass | 238.03 |
| IUPAC Name | N-methyl-5-(1,3,4-thiadiazol-2-ylsulfanylmethyl)pyridin-2-amine |
| SMILES | CNc1ccc(CSc2nncs2)cn1 |
| InChI | InChI=1S/C9H10N4S2/c1-10-8-3-2-7(4-11-8)5-14-9-13-12-6-15-9/h2-4,6H,5H2,1H3,(H,10,11) |
| InChIKey | GKYKELDGJUOQOC-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.34 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-methyl-5-(1,3,4-thiadiazol-2-ylsulfanylmethyl)pyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-5-(1,3,4-thiadiazol-2-ylsulfanylmethyl)pyridin-2-amine?
The IUPAC name of N-methyl-5-(1,3,4-thiadiazol-2-ylsulfanylmethyl)pyridin-2-amine (CID 62188235) is N-methyl-5-(1,3,4-thiadiazol-2-ylsulfanylmethyl)pyridin-2-amine.
What is the SMILES notation for N-methyl-5-(1,3,4-thiadiazol-2-ylsulfanylmethyl)pyridin-2-amine?
The canonical SMILES for N-methyl-5-(1,3,4-thiadiazol-2-ylsulfanylmethyl)pyridin-2-amine is CNc1ccc(CSc2nncs2)cn1.
What is the InChIKey of N-methyl-5-(1,3,4-thiadiazol-2-ylsulfanylmethyl)pyridin-2-amine?
The InChIKey is GKYKELDGJUOQOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N4S2/c1-10-8-3-2-7(4-11-8)5-14-9-13-12-6-15-9/h2-4,6H,5H2,1H3,(H,10,11).
What are the key properties of N-methyl-5-(1,3,4-thiadiazol-2-ylsulfanylmethyl)pyridin-2-amine?
N-methyl-5-(1,3,4-thiadiazol-2-ylsulfanylmethyl)pyridin-2-amine has a molecular weight of 238.34 g/mol, XLogP of 2.27, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-5-(1,3,4-thiadiazol-2-ylsulfanylmethyl)pyridin-2-amine is sourced from PubChem (CID 62188235), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).