C13H11F3N2O3 — CID 62188335
ethyl 4-amino-8-(trifluoromethoxy)quinoline-3-carboxylate (PubChem CID 62188335) has the molecular formula C13H11F3N2O3 and a molecular weight of 300.24 g/mol. Its IUPAC name is ethyl 4-amino-8-(trifluoromethoxy)quinoline-3-carboxylate.
| Compound Name | ethyl 4-amino-8-(trifluoromethoxy)quinoline-3-carboxylate |
|---|---|
| PubChem CID | 62188335 |
| Molecular Formula | C13H11F3N2O3 |
| Molecular Weight | 300.24 g/mol |
| Exact Mass | 300.07 |
| IUPAC Name | ethyl 4-amino-8-(trifluoromethoxy)quinoline-3-carboxylate |
| SMILES | CCOC(=O)c1cnc2c(OC(F)(F)F)cccc2c1N |
| InChI | InChI=1S/C13H11F3N2O3/c1-2-20-12(19)8-6-18-11-7(10(8)17)4-3-5-9(11)21-13(14,15)16/h3-6H,2H2,1H3,(H2,17,18) |
| InChIKey | KWGHPOKKRNGCRL-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 74.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.24 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |