About N-methyl-2-[(4-methyl-1,3-thiazol-2-yl)sulfanylmethyl]thieno[2,3-d]pyrimidin-4-amine
N-methyl-2-[(4-methyl-1,3-thiazol-2-yl)sulfanylmethyl]thieno[2,3-d]pyrimidin-4-amine (PubChem CID 62189283) has the molecular formula C12H12N4S3
and a molecular weight of 308.46 g/mol. Its IUPAC name is N-methyl-2-[(4-methyl-1,3-thiazol-2-yl)sulfanylmethyl]thieno[2,3-d]pyrimidin-4-amine.
Molecular Properties
| Compound Name | N-methyl-2-[(4-methyl-1,3-thiazol-2-yl)sulfanylmethyl]thieno[2,3-d]pyrimidin-4-amine |
| PubChem CID | 62189283 |
| Molecular Formula | C12H12N4S3 |
| Molecular Weight | 308.46 g/mol |
| Exact Mass | 308.02 |
| IUPAC Name | N-methyl-2-[(4-methyl-1,3-thiazol-2-yl)sulfanylmethyl]thieno[2,3-d]pyrimidin-4-amine |
| SMILES | CNc1nc(CSc2nc(C)cs2)nc2sccc12 |
| InChI | InChI=1S/C12H12N4S3/c1-7-5-18-12(14-7)19-6-9-15-10(13-2)8-3-4-17-11(8)16-9/h3-5H,6H2,1-2H3,(H,13,15,16) |
| InChIKey | QWQIIZHRTRODMV-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.46 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze N-methyl-2-[(4-methyl-1,3-thiazol-2-yl)sulfanylmethyl]thieno[2,3-d]pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-2-[(4-methyl-1,3-thiazol-2-yl)sulfanylmethyl]thieno[2,3-d]pyrimidin-4-amine?
The IUPAC name of N-methyl-2-[(4-methyl-1,3-thiazol-2-yl)sulfanylmethyl]thieno[2,3-d]pyrimidin-4-amine (CID 62189283) is N-methyl-2-[(4-methyl-1,3-thiazol-2-yl)sulfanylmethyl]thieno[2,3-d]pyrimidin-4-amine.
What is the SMILES notation for N-methyl-2-[(4-methyl-1,3-thiazol-2-yl)sulfanylmethyl]thieno[2,3-d]pyrimidin-4-amine?
The canonical SMILES for N-methyl-2-[(4-methyl-1,3-thiazol-2-yl)sulfanylmethyl]thieno[2,3-d]pyrimidin-4-amine is CNc1nc(CSc2nc(C)cs2)nc2sccc12.
What is the InChIKey of N-methyl-2-[(4-methyl-1,3-thiazol-2-yl)sulfanylmethyl]thieno[2,3-d]pyrimidin-4-amine?
The InChIKey is QWQIIZHRTRODMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N4S3/c1-7-5-18-12(14-7)19-6-9-15-10(13-2)8-3-4-17-11(8)16-9/h3-5H,6H2,1-2H3,(H,13,15,16).
What are the key properties of N-methyl-2-[(4-methyl-1,3-thiazol-2-yl)sulfanylmethyl]thieno[2,3-d]pyrimidin-4-amine?
N-methyl-2-[(4-methyl-1,3-thiazol-2-yl)sulfanylmethyl]thieno[2,3-d]pyrimidin-4-amine has a molecular weight of 308.46 g/mol, XLogP of 3.79, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-2-[(4-methyl-1,3-thiazol-2-yl)sulfanylmethyl]thieno[2,3-d]pyrimidin-4-amine is sourced from PubChem (CID 62189283), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).