About N-ethyl-4-[(4-methyl-1,3-thiazol-2-yl)sulfanylmethyl]thiadiazol-5-amine
N-ethyl-4-[(4-methyl-1,3-thiazol-2-yl)sulfanylmethyl]thiadiazol-5-amine (PubChem CID 62189635) has the molecular formula C9H12N4S3
and a molecular weight of 272.42 g/mol. Its IUPAC name is N-ethyl-4-[(4-methyl-1,3-thiazol-2-yl)sulfanylmethyl]thiadiazol-5-amine.
Molecular Properties
| Compound Name | N-ethyl-4-[(4-methyl-1,3-thiazol-2-yl)sulfanylmethyl]thiadiazol-5-amine |
| PubChem CID | 62189635 |
| Molecular Formula | C9H12N4S3 |
| Molecular Weight | 272.42 g/mol |
| Exact Mass | 272.02 |
| IUPAC Name | N-ethyl-4-[(4-methyl-1,3-thiazol-2-yl)sulfanylmethyl]thiadiazol-5-amine |
| SMILES | CCNc1snnc1CSc1nc(C)cs1 |
| InChI | InChI=1S/C9H12N4S3/c1-3-10-8-7(12-13-16-8)5-15-9-11-6(2)4-14-9/h4,10H,3,5H2,1-2H3 |
| InChIKey | LWENSKYQGAHOJA-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.42 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze N-ethyl-4-[(4-methyl-1,3-thiazol-2-yl)sulfanylmethyl]thiadiazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-4-[(4-methyl-1,3-thiazol-2-yl)sulfanylmethyl]thiadiazol-5-amine?
The IUPAC name of N-ethyl-4-[(4-methyl-1,3-thiazol-2-yl)sulfanylmethyl]thiadiazol-5-amine (CID 62189635) is N-ethyl-4-[(4-methyl-1,3-thiazol-2-yl)sulfanylmethyl]thiadiazol-5-amine.
What is the SMILES notation for N-ethyl-4-[(4-methyl-1,3-thiazol-2-yl)sulfanylmethyl]thiadiazol-5-amine?
The canonical SMILES for N-ethyl-4-[(4-methyl-1,3-thiazol-2-yl)sulfanylmethyl]thiadiazol-5-amine is CCNc1snnc1CSc1nc(C)cs1.
What is the InChIKey of N-ethyl-4-[(4-methyl-1,3-thiazol-2-yl)sulfanylmethyl]thiadiazol-5-amine?
The InChIKey is LWENSKYQGAHOJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N4S3/c1-3-10-8-7(12-13-16-8)5-15-9-11-6(2)4-14-9/h4,10H,3,5H2,1-2H3.
What are the key properties of N-ethyl-4-[(4-methyl-1,3-thiazol-2-yl)sulfanylmethyl]thiadiazol-5-amine?
N-ethyl-4-[(4-methyl-1,3-thiazol-2-yl)sulfanylmethyl]thiadiazol-5-amine has a molecular weight of 272.42 g/mol, XLogP of 3.03, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-4-[(4-methyl-1,3-thiazol-2-yl)sulfanylmethyl]thiadiazol-5-amine is sourced from PubChem (CID 62189635), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).