C21H18N4O3S2 — CID 6219016
(NZ)-2,4,6-trimethyl-N-[4-oxo-3-(1H-1,2,4-triazol-5-ylsulfanyl)naphthalen-1-ylidene]benzenesulfonamide (PubChem CID 6219016) has the molecular formula C21H18N4O3S2 and a molecular weight of 438.53 g/mol. Its IUPAC name is (NZ)-2,4,6-trimethyl-N-[4-oxo-3-(1H-1,2,4-triazol-5-ylsulfanyl)naphthalen-1-ylidene]benzenesulfonamide.
| Compound Name | (NZ)-2,4,6-trimethyl-N-[4-oxo-3-(1H-1,2,4-triazol-5-ylsulfanyl)naphthalen-1-ylidene]benzenesulfonamide |
|---|---|
| PubChem CID | 6219016 |
| Molecular Formula | C21H18N4O3S2 |
| Molecular Weight | 438.53 g/mol |
| Exact Mass | 438.08 |
| IUPAC Name | (NZ)-2,4,6-trimethyl-N-[4-oxo-3-(1H-1,2,4-triazol-5-ylsulfanyl)naphthalen-1-ylidene]benzenesulfonamide |
| SMILES | Cc1cc(C)c(S(=O)(=O)/N=C2/C=C(Sc3ncn[nH]3)C(=O)c3ccccc32)c(C)c1 |
| InChI | InChI=1S/C21H18N4O3S2/c1-12-8-13(2)20(14(3)9-12)30(27,28)25-17-10-18(29-21-22-11-23-24-21)19(26)16-7-5-4-6-15(16)17/h4-11H,1-3H3,(H,22,23,24)/b25-17- |
| InChIKey | ZTQLHGRSHMZCRJ-UQQQWYQISA-N |
| XLogP | 3.78 |
| TPSA | 105.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.53 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|