About 2-(furan-2-yl)-N,6-dimethylpyrimidin-4-amine
2-(furan-2-yl)-N,6-dimethylpyrimidin-4-amine (PubChem CID 62190628) has the molecular formula C10H11N3O
and a molecular weight of 189.22 g/mol. Its IUPAC name is 2-(furan-2-yl)-N,6-dimethylpyrimidin-4-amine.
Molecular Properties
| Compound Name | 2-(furan-2-yl)-N,6-dimethylpyrimidin-4-amine |
| PubChem CID | 62190628 |
| Molecular Formula | C10H11N3O |
| Molecular Weight | 189.22 g/mol |
| Exact Mass | 189.09 |
| IUPAC Name | 2-(furan-2-yl)-N,6-dimethylpyrimidin-4-amine |
| SMILES | CNc1cc(C)nc(-c2ccco2)n1 |
| InChI | InChI=1S/C10H11N3O/c1-7-6-9(11-2)13-10(12-7)8-4-3-5-14-8/h3-6H,1-2H3,(H,11,12,13) |
| InChIKey | SAURPXDDADEEPZ-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.22 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(furan-2-yl)-N,6-dimethylpyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(furan-2-yl)-N,6-dimethylpyrimidin-4-amine?
The IUPAC name of 2-(furan-2-yl)-N,6-dimethylpyrimidin-4-amine (CID 62190628) is 2-(furan-2-yl)-N,6-dimethylpyrimidin-4-amine.
What is the SMILES notation for 2-(furan-2-yl)-N,6-dimethylpyrimidin-4-amine?
The canonical SMILES for 2-(furan-2-yl)-N,6-dimethylpyrimidin-4-amine is CNc1cc(C)nc(-c2ccco2)n1.
What is the InChIKey of 2-(furan-2-yl)-N,6-dimethylpyrimidin-4-amine?
The InChIKey is SAURPXDDADEEPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11N3O/c1-7-6-9(11-2)13-10(12-7)8-4-3-5-14-8/h3-6H,1-2H3,(H,11,12,13).
What are the key properties of 2-(furan-2-yl)-N,6-dimethylpyrimidin-4-amine?
2-(furan-2-yl)-N,6-dimethylpyrimidin-4-amine has a molecular weight of 189.22 g/mol, XLogP of 2.09, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(furan-2-yl)-N,6-dimethylpyrimidin-4-amine is sourced from PubChem (CID 62190628), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).