C18H18ClNO2S — CID 6219239
N-(5-chloro-2-methoxyphenyl)-2-[(E)-3-phenylprop-2-enyl]sulfanylacetamide (PubChem CID 6219239) has the molecular formula C18H18ClNO2S and a molecular weight of 347.87 g/mol. Its IUPAC name is N-(5-chloro-2-methoxyphenyl)-2-[(E)-3-phenylprop-2-enyl]sulfanylacetamide.
| Compound Name | N-(5-chloro-2-methoxyphenyl)-2-[(E)-3-phenylprop-2-enyl]sulfanylacetamide |
|---|---|
| PubChem CID | 6219239 |
| Molecular Formula | C18H18ClNO2S |
| Molecular Weight | 347.87 g/mol |
| Exact Mass | 347.07 |
| IUPAC Name | N-(5-chloro-2-methoxyphenyl)-2-[(E)-3-phenylprop-2-enyl]sulfanylacetamide |
| SMILES | COc1ccc(Cl)cc1NC(=O)CSC/C=C/c1ccccc1 |
| InChI | InChI=1S/C18H18ClNO2S/c1-22-17-10-9-15(19)12-16(17)20-18(21)13-23-11-5-8-14-6-3-2-4-7-14/h2-10,12H,11,13H2,1H3,(H,20,21)/b8-5+ |
| InChIKey | AMXIKOFDTLUXCY-VMPITWQZSA-N |
| XLogP | 4.73 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.87 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|