About 2-[(2,4-difluorophenoxy)methyl]thieno[2,3-d]pyrimidin-4-amine
2-[(2,4-difluorophenoxy)methyl]thieno[2,3-d]pyrimidin-4-amine (PubChem CID 62193500) has the molecular formula C13H9F2N3OS
and a molecular weight of 293.30 g/mol. Its IUPAC name is 2-[(2,4-difluorophenoxy)methyl]thieno[2,3-d]pyrimidin-4-amine.
Molecular Properties
| Compound Name | 2-[(2,4-difluorophenoxy)methyl]thieno[2,3-d]pyrimidin-4-amine |
| PubChem CID | 62193500 |
| Molecular Formula | C13H9F2N3OS |
| Molecular Weight | 293.30 g/mol |
| Exact Mass | 293.04 |
| IUPAC Name | 2-[(2,4-difluorophenoxy)methyl]thieno[2,3-d]pyrimidin-4-amine |
| SMILES | Nc1nc(COc2ccc(F)cc2F)nc2sccc12 |
| InChI | InChI=1S/C13H9F2N3OS/c14-7-1-2-10(9(15)5-7)19-6-11-17-12(16)8-3-4-20-13(8)18-11/h1-5H,6H2,(H2,16,17,18) |
| InChIKey | QNJDZPIBMPVYGB-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.30 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[(2,4-difluorophenoxy)methyl]thieno[2,3-d]pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2,4-difluorophenoxy)methyl]thieno[2,3-d]pyrimidin-4-amine?
The IUPAC name of 2-[(2,4-difluorophenoxy)methyl]thieno[2,3-d]pyrimidin-4-amine (CID 62193500) is 2-[(2,4-difluorophenoxy)methyl]thieno[2,3-d]pyrimidin-4-amine.
What is the SMILES notation for 2-[(2,4-difluorophenoxy)methyl]thieno[2,3-d]pyrimidin-4-amine?
The canonical SMILES for 2-[(2,4-difluorophenoxy)methyl]thieno[2,3-d]pyrimidin-4-amine is Nc1nc(COc2ccc(F)cc2F)nc2sccc12.
What is the InChIKey of 2-[(2,4-difluorophenoxy)methyl]thieno[2,3-d]pyrimidin-4-amine?
The InChIKey is QNJDZPIBMPVYGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9F2N3OS/c14-7-1-2-10(9(15)5-7)19-6-11-17-12(16)8-3-4-20-13(8)18-11/h1-5H,6H2,(H2,16,17,18).
What are the key properties of 2-[(2,4-difluorophenoxy)methyl]thieno[2,3-d]pyrimidin-4-amine?
2-[(2,4-difluorophenoxy)methyl]thieno[2,3-d]pyrimidin-4-amine has a molecular weight of 293.30 g/mol, XLogP of 3.13, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2,4-difluorophenoxy)methyl]thieno[2,3-d]pyrimidin-4-amine is sourced from PubChem (CID 62193500), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).