About 4-[(2,4-difluorophenoxy)methyl]-N-methylthiadiazol-5-amine
4-[(2,4-difluorophenoxy)methyl]-N-methylthiadiazol-5-amine (PubChem CID 62193681) has the molecular formula C10H9F2N3OS
and a molecular weight of 257.26 g/mol. Its IUPAC name is 4-[(2,4-difluorophenoxy)methyl]-N-methylthiadiazol-5-amine.
Molecular Properties
| Compound Name | 4-[(2,4-difluorophenoxy)methyl]-N-methylthiadiazol-5-amine |
| PubChem CID | 62193681 |
| Molecular Formula | C10H9F2N3OS |
| Molecular Weight | 257.26 g/mol |
| Exact Mass | 257.04 |
| IUPAC Name | 4-[(2,4-difluorophenoxy)methyl]-N-methylthiadiazol-5-amine |
| SMILES | CNc1snnc1COc1ccc(F)cc1F |
| InChI | InChI=1S/C10H9F2N3OS/c1-13-10-8(14-15-17-10)5-16-9-3-2-6(11)4-7(9)12/h2-4,13H,5H2,1H3 |
| InChIKey | JHQCMMMLPIAPAX-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.26 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[(2,4-difluorophenoxy)methyl]-N-methylthiadiazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2,4-difluorophenoxy)methyl]-N-methylthiadiazol-5-amine?
The IUPAC name of 4-[(2,4-difluorophenoxy)methyl]-N-methylthiadiazol-5-amine (CID 62193681) is 4-[(2,4-difluorophenoxy)methyl]-N-methylthiadiazol-5-amine.
What is the SMILES notation for 4-[(2,4-difluorophenoxy)methyl]-N-methylthiadiazol-5-amine?
The canonical SMILES for 4-[(2,4-difluorophenoxy)methyl]-N-methylthiadiazol-5-amine is CNc1snnc1COc1ccc(F)cc1F.
What is the InChIKey of 4-[(2,4-difluorophenoxy)methyl]-N-methylthiadiazol-5-amine?
The InChIKey is JHQCMMMLPIAPAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9F2N3OS/c1-13-10-8(14-15-17-10)5-16-9-3-2-6(11)4-7(9)12/h2-4,13H,5H2,1H3.
What are the key properties of 4-[(2,4-difluorophenoxy)methyl]-N-methylthiadiazol-5-amine?
4-[(2,4-difluorophenoxy)methyl]-N-methylthiadiazol-5-amine has a molecular weight of 257.26 g/mol, XLogP of 2.44, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2,4-difluorophenoxy)methyl]-N-methylthiadiazol-5-amine is sourced from PubChem (CID 62193681), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).