C11H12N2O2 — CID 62194670
(2-amino-7-methoxyquinolin-3-yl)methanol (PubChem CID 62194670) has the molecular formula C11H12N2O2 and a molecular weight of 204.23 g/mol. Its IUPAC name is (2-amino-7-methoxyquinolin-3-yl)methanol.
| Compound Name | (2-amino-7-methoxyquinolin-3-yl)methanol |
|---|---|
| PubChem CID | 62194670 |
| Molecular Formula | C11H12N2O2 |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.09 |
| IUPAC Name | (2-amino-7-methoxyquinolin-3-yl)methanol |
| SMILES | COc1ccc2cc(CO)c(N)nc2c1 |
| InChI | InChI=1S/C11H12N2O2/c1-15-9-3-2-7-4-8(6-14)11(12)13-10(7)5-9/h2-5,14H,6H2,1H3,(H2,12,13) |
| InChIKey | LACYHECNDFKOGM-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 68.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.23 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |