C13H14N4O3S — CID 62194704
4-[(4-amino-5,6-dimethylthieno[2,3-d]pyrimidin-2-yl)methyl]morpholine-3,5-dione (PubChem CID 62194704) has the molecular formula C13H14N4O3S and a molecular weight of 306.35 g/mol. Its IUPAC name is 4-[(4-amino-5,6-dimethylthieno[2,3-d]pyrimidin-2-yl)methyl]morpholine-3,5-dione.
| Compound Name | 4-[(4-amino-5,6-dimethylthieno[2,3-d]pyrimidin-2-yl)methyl]morpholine-3,5-dione |
|---|---|
| PubChem CID | 62194704 |
| Molecular Formula | C13H14N4O3S |
| Molecular Weight | 306.35 g/mol |
| Exact Mass | 306.08 |
| IUPAC Name | 4-[(4-amino-5,6-dimethylthieno[2,3-d]pyrimidin-2-yl)methyl]morpholine-3,5-dione |
| SMILES | Cc1sc2nc(CN3C(=O)COCC3=O)nc(N)c2c1C |
| InChI | InChI=1S/C13H14N4O3S/c1-6-7(2)21-13-11(6)12(14)15-8(16-13)3-17-9(18)4-20-5-10(17)19/h3-5H2,1-2H3,(H2,14,15,16) |
| InChIKey | QNMIOHANEGLHOB-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 98.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.35 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|