C13H13ClN2O2 — CID 621951
1-(3-chloro-4-methylphenyl)-4-propan-2-ylidenepyrazolidine-3,5-dione (PubChem CID 621951) has the molecular formula C13H13ClN2O2 and a molecular weight of 264.71 g/mol. Its IUPAC name is 1-(3-chloro-4-methylphenyl)-4-propan-2-ylidenepyrazolidine-3,5-dione.
| Compound Name | 1-(3-chloro-4-methylphenyl)-4-propan-2-ylidenepyrazolidine-3,5-dione |
|---|---|
| PubChem CID | 621951 |
| Molecular Formula | C13H13ClN2O2 |
| Molecular Weight | 264.71 g/mol |
| Exact Mass | 264.07 |
| IUPAC Name | 1-(3-chloro-4-methylphenyl)-4-propan-2-ylidenepyrazolidine-3,5-dione |
| SMILES | CC(C)=C1C(=O)NN(c2ccc(C)c(Cl)c2)C1=O |
| InChI | InChI=1S/C13H13ClN2O2/c1-7(2)11-12(17)15-16(13(11)18)9-5-4-8(3)10(14)6-9/h4-6H,1-3H3,(H,15,17) |
| InChIKey | YIROPWFEEYIJHT-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.71 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'ene_five_het_D(46)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|