C13H15ClN2 — CID 62195933
6-chloro-N,2,3,8-tetramethylquinolin-4-amine (PubChem CID 62195933) has the molecular formula C13H15ClN2 and a molecular weight of 234.73 g/mol. Its IUPAC name is 6-chloro-N,2,3,8-tetramethylquinolin-4-amine.
| Compound Name | 6-chloro-N,2,3,8-tetramethylquinolin-4-amine |
|---|---|
| PubChem CID | 62195933 |
| Molecular Formula | C13H15ClN2 |
| Molecular Weight | 234.73 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | 6-chloro-N,2,3,8-tetramethylquinolin-4-amine |
| SMILES | CNc1c(C)c(C)nc2c(C)cc(Cl)cc12 |
| InChI | InChI=1S/C13H15ClN2/c1-7-5-10(14)6-11-12(7)16-9(3)8(2)13(11)15-4/h5-6H,1-4H3,(H,15,16) |
| InChIKey | KZUCLSHZLKJIED-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.73 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |