About 2-tert-butyl-7,8-difluoroquinolin-4-amine
2-tert-butyl-7,8-difluoroquinolin-4-amine (PubChem CID 62196443) has the molecular formula C13H14F2N2
and a molecular weight of 236.26 g/mol. Its IUPAC name is 2-tert-butyl-7,8-difluoroquinolin-4-amine.
Molecular Properties
| Compound Name | 2-tert-butyl-7,8-difluoroquinolin-4-amine |
| PubChem CID | 62196443 |
| Molecular Formula | C13H14F2N2 |
| Molecular Weight | 236.26 g/mol |
| Exact Mass | 236.11 |
| IUPAC Name | 2-tert-butyl-7,8-difluoroquinolin-4-amine |
| SMILES | CC(C)(C)c1cc(N)c2ccc(F)c(F)c2n1 |
| InChI | InChI=1S/C13H14F2N2/c1-13(2,3)10-6-9(16)7-4-5-8(14)11(15)12(7)17-10/h4-6H,1-3H3,(H2,16,17) |
| InChIKey | GGXKDULPMOTZBV-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.26 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-tert-butyl-7,8-difluoroquinolin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butyl-7,8-difluoroquinolin-4-amine?
The IUPAC name of 2-tert-butyl-7,8-difluoroquinolin-4-amine (CID 62196443) is 2-tert-butyl-7,8-difluoroquinolin-4-amine.
What is the SMILES notation for 2-tert-butyl-7,8-difluoroquinolin-4-amine?
The canonical SMILES for 2-tert-butyl-7,8-difluoroquinolin-4-amine is CC(C)(C)c1cc(N)c2ccc(F)c(F)c2n1.
What is the InChIKey of 2-tert-butyl-7,8-difluoroquinolin-4-amine?
The InChIKey is GGXKDULPMOTZBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14F2N2/c1-13(2,3)10-6-9(16)7-4-5-8(14)11(15)12(7)17-10/h4-6H,1-3H3,(H2,16,17).
What are the key properties of 2-tert-butyl-7,8-difluoroquinolin-4-amine?
2-tert-butyl-7,8-difluoroquinolin-4-amine has a molecular weight of 236.26 g/mol, XLogP of 3.39, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butyl-7,8-difluoroquinolin-4-amine is sourced from PubChem (CID 62196443), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).