C16H16N4 — CID 621971
1,4-dimethyl-3,6-diphenyl-1,2,4,5-tetrazine (PubChem CID 621971) has the molecular formula C16H16N4 and a molecular weight of 264.33 g/mol. Its IUPAC name is 1,4-dimethyl-3,6-diphenyl-1,2,4,5-tetrazine.
| Compound Name | 1,4-dimethyl-3,6-diphenyl-1,2,4,5-tetrazine |
|---|---|
| PubChem CID | 621971 |
| Molecular Formula | C16H16N4 |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | 1,4-dimethyl-3,6-diphenyl-1,2,4,5-tetrazine |
| SMILES | CN1N=C(c2ccccc2)N(C)N=C1c1ccccc1 |
| InChI | InChI=1S/C16H16N4/c1-19-15(13-9-5-3-6-10-13)18-20(2)16(17-19)14-11-7-4-8-12-14/h3-12H,1-2H3 |
| InChIKey | DJVANJCJHCKTFF-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 31.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |