C12H14F2N2OS2 — CID 62197469
N-[[5-(difluoromethylsulfanylmethyl)furan-2-yl]methyl]-2-(1,3-thiazol-2-yl)ethanamine (PubChem CID 62197469) has the molecular formula C12H14F2N2OS2 and a molecular weight of 304.39 g/mol. Its IUPAC name is N-[[5-(difluoromethylsulfanylmethyl)furan-2-yl]methyl]-2-(1,3-thiazol-2-yl)ethanamine.
| Compound Name | N-[[5-(difluoromethylsulfanylmethyl)furan-2-yl]methyl]-2-(1,3-thiazol-2-yl)ethanamine |
|---|---|
| PubChem CID | 62197469 |
| Molecular Formula | C12H14F2N2OS2 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.05 |
| IUPAC Name | N-[[5-(difluoromethylsulfanylmethyl)furan-2-yl]methyl]-2-(1,3-thiazol-2-yl)ethanamine |
| SMILES | FC(F)SCc1ccc(CNCCc2nccs2)o1 |
| InChI | InChI=1S/C12H14F2N2OS2/c13-12(14)19-8-10-2-1-9(17-10)7-15-4-3-11-16-5-6-18-11/h1-2,5-6,12,15H,3-4,7-8H2 |
| InChIKey | OPURDOUFBJUGQT-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|