C13H12F2N2O — CID 62197636
3-[(2,4-difluorophenyl)methoxy]-6-methylpyridin-2-amine (PubChem CID 62197636) has the molecular formula C13H12F2N2O and a molecular weight of 250.25 g/mol. Its IUPAC name is 3-[(2,4-difluorophenyl)methoxy]-6-methylpyridin-2-amine.
| Compound Name | 3-[(2,4-difluorophenyl)methoxy]-6-methylpyridin-2-amine |
|---|---|
| PubChem CID | 62197636 |
| Molecular Formula | C13H12F2N2O |
| Molecular Weight | 250.25 g/mol |
| Exact Mass | 250.09 |
| IUPAC Name | 3-[(2,4-difluorophenyl)methoxy]-6-methylpyridin-2-amine |
| SMILES | Cc1ccc(OCc2ccc(F)cc2F)c(N)n1 |
| InChI | InChI=1S/C13H12F2N2O/c1-8-2-5-12(13(16)17-8)18-7-9-3-4-10(14)6-11(9)15/h2-6H,7H2,1H3,(H2,16,17) |
| InChIKey | UUJVYRTUVRHURH-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.25 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_OC_no_alk_C(3)', 'substructure': 'N/A'} |
|---|