C15H14F2O3 — CID 62198124
[3-[(2,4-difluorophenyl)methoxy]-4-methoxyphenyl]methanol (PubChem CID 62198124) has the molecular formula C15H14F2O3 and a molecular weight of 280.27 g/mol. Its IUPAC name is [3-[(2,4-difluorophenyl)methoxy]-4-methoxyphenyl]methanol.
| Compound Name | [3-[(2,4-difluorophenyl)methoxy]-4-methoxyphenyl]methanol |
|---|---|
| PubChem CID | 62198124 |
| Molecular Formula | C15H14F2O3 |
| Molecular Weight | 280.27 g/mol |
| Exact Mass | 280.09 |
| IUPAC Name | [3-[(2,4-difluorophenyl)methoxy]-4-methoxyphenyl]methanol |
| SMILES | COc1ccc(CO)cc1OCc1ccc(F)cc1F |
| InChI | InChI=1S/C15H14F2O3/c1-19-14-5-2-10(8-18)6-15(14)20-9-11-3-4-12(16)7-13(11)17/h2-7,18H,8-9H2,1H3 |
| InChIKey | AICUQLVNMJKJIO-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.27 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |