C14H13N3 — CID 62198217
2-amino-6-(4-ethylphenyl)pyridine-3-carbonitrile (PubChem CID 62198217) has the molecular formula C14H13N3 and a molecular weight of 223.28 g/mol. Its IUPAC name is 2-amino-6-(4-ethylphenyl)pyridine-3-carbonitrile.
| Compound Name | 2-amino-6-(4-ethylphenyl)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 62198217 |
| Molecular Formula | C14H13N3 |
| Molecular Weight | 223.28 g/mol |
| Exact Mass | 223.11 |
| IUPAC Name | 2-amino-6-(4-ethylphenyl)pyridine-3-carbonitrile |
| SMILES | CCc1ccc(-c2ccc(C#N)c(N)n2)cc1 |
| InChI | InChI=1S/C14H13N3/c1-2-10-3-5-11(6-4-10)13-8-7-12(9-15)14(16)17-13/h3-8H,2H2,1H3,(H2,16,17) |
| InChIKey | GZGLIFYYGZSJQT-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 62.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.28 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |