C12H12N4O3S — CID 62198427
3-nitro-4-[2-(1,3-thiazol-2-yl)ethylamino]benzamide (PubChem CID 62198427) has the molecular formula C12H12N4O3S and a molecular weight of 292.32 g/mol. Its IUPAC name is 3-nitro-4-[2-(1,3-thiazol-2-yl)ethylamino]benzamide.
| Compound Name | 3-nitro-4-[2-(1,3-thiazol-2-yl)ethylamino]benzamide |
|---|---|
| PubChem CID | 62198427 |
| Molecular Formula | C12H12N4O3S |
| Molecular Weight | 292.32 g/mol |
| Exact Mass | 292.06 |
| IUPAC Name | 3-nitro-4-[2-(1,3-thiazol-2-yl)ethylamino]benzamide |
| SMILES | NC(=O)c1ccc(NCCc2nccs2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C12H12N4O3S/c13-12(17)8-1-2-9(10(7-8)16(18)19)14-4-3-11-15-5-6-20-11/h1-2,5-7,14H,3-4H2,(H2,13,17) |
| InChIKey | WBHYLWMJONCFLH-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 111.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.32 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|