C13H17N3O4S — CID 62199773
4-(2,3-dihydro-1-benzofuran-5-carbonyl)piperazine-1-sulfonamide (PubChem CID 62199773) has the molecular formula C13H17N3O4S and a molecular weight of 311.36 g/mol. Its IUPAC name is 4-(2,3-dihydro-1-benzofuran-5-carbonyl)piperazine-1-sulfonamide.
| Compound Name | 4-(2,3-dihydro-1-benzofuran-5-carbonyl)piperazine-1-sulfonamide |
|---|---|
| PubChem CID | 62199773 |
| Molecular Formula | C13H17N3O4S |
| Molecular Weight | 311.36 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | 4-(2,3-dihydro-1-benzofuran-5-carbonyl)piperazine-1-sulfonamide |
| SMILES | NS(=O)(=O)N1CCN(C(=O)c2ccc3c(c2)CCO3)CC1 |
| InChI | InChI=1S/C13H17N3O4S/c14-21(18,19)16-6-4-15(5-7-16)13(17)11-1-2-12-10(9-11)3-8-20-12/h1-2,9H,3-8H2,(H2,14,18,19) |
| InChIKey | QUNXDVDMDDPOPF-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 92.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.36 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |