C11H20N4O2 — CID 62200621
6-(hexan-2-ylamino)-2,4-dimethyl-1,2,4-triazine-3,5-dione (PubChem CID 62200621) has the molecular formula C11H20N4O2 and a molecular weight of 240.31 g/mol. Its IUPAC name is 6-(hexan-2-ylamino)-2,4-dimethyl-1,2,4-triazine-3,5-dione.
| Compound Name | 6-(hexan-2-ylamino)-2,4-dimethyl-1,2,4-triazine-3,5-dione |
|---|---|
| PubChem CID | 62200621 |
| Molecular Formula | C11H20N4O2 |
| Molecular Weight | 240.31 g/mol |
| Exact Mass | 240.16 |
| IUPAC Name | 6-(hexan-2-ylamino)-2,4-dimethyl-1,2,4-triazine-3,5-dione |
| SMILES | CCCCC(C)Nc1nn(C)c(=O)n(C)c1=O |
| InChI | InChI=1S/C11H20N4O2/c1-5-6-7-8(2)12-9-10(16)14(3)11(17)15(4)13-9/h8H,5-7H2,1-4H3,(H,12,13) |
| InChIKey | KNCWECSBLXEUCK-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 68.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.31 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |