C30H26N2O5S — CID 6220109
(4E)-5-(4-ethoxyphenyl)-4-[hydroxy-[4-[(3-methylphenyl)methoxy]phenyl]methylidene]-1-(1,3-thiazol-2-yl)pyrrolidine-2,3-dione (PubChem CID 6220109) has the molecular formula C30H26N2O5S and a molecular weight of 526.61 g/mol. Its IUPAC name is (4E)-5-(4-ethoxyphenyl)-4-[hydroxy-[4-[(3-methylphenyl)methoxy]phenyl]methylidene]-1-(1,3-thiazol-2-yl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-5-(4-ethoxyphenyl)-4-[hydroxy-[4-[(3-methylphenyl)methoxy]phenyl]methylidene]-1-(1,3-thiazol-2-yl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 6220109 |
| Molecular Formula | C30H26N2O5S |
| Molecular Weight | 526.61 g/mol |
| Exact Mass | 526.16 |
| IUPAC Name | (4E)-5-(4-ethoxyphenyl)-4-[hydroxy-[4-[(3-methylphenyl)methoxy]phenyl]methylidene]-1-(1,3-thiazol-2-yl)pyrrolidine-2,3-dione |
| SMILES | CCOc1ccc(C2/C(=C(\O)c3ccc(OCc4cccc(C)c4)cc3)C(=O)C(=O)N2c2nccs2)cc1 |
| InChI | InChI=1S/C30H26N2O5S/c1-3-36-23-11-7-21(8-12-23)26-25(28(34)29(35)32(26)30-31-15-16-38-30)27(33)22-9-13-24(14-10-22)37-18-20-6-4-5-19(2)17-20/h4-17,26,33H,3,18H2,1-2H3/b27-25+ |
| InChIKey | CECIJFWGVKLNEO-IMVLJIQESA-N |
| XLogP | 6.06 |
| TPSA | 88.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.61 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|