3-(1-hexan-2-yl-4,6-dimethyl-2-oxopyrimidin-5-yl)propanoic acid

C15H24N2O3 — CID 62201200

IUPAC3-(1-hexan-2-yl-4,6-dimethyl-2-oxopyrimidin-5-yl)propanoic acid
SMILESCCCCC(C)n1c(C)c(CCC(=O)O)c(C)nc1=O
InChIInChI=1S/C15H24N2O3/c1-5-6-7-10(2)17-12(4)13(8-9-14(18)19)11(3)16-15(17)20/h10H,5-9H2,1-4H3,(H,18,19)
InChIKeyAYYFXWZUBJGJFZ-UHFFFAOYSA-N
MW280.37 g/mol
LogP2.63
Rot. Bonds7

About 3-(1-hexan-2-yl-4,6-dimethyl-2-oxopyrimidin-5-yl)propanoic acid

3-(1-hexan-2-yl-4,6-dimethyl-2-oxopyrimidin-5-yl)propanoic acid (PubChem CID 62201200) has the molecular formula C15H24N2O3 and a molecular weight of 280.37 g/mol. Its IUPAC name is 3-(1-hexan-2-yl-4,6-dimethyl-2-oxopyrimidin-5-yl)propanoic acid.

Molecular Properties

Compound Name3-(1-hexan-2-yl-4,6-dimethyl-2-oxopyrimidin-5-yl)propanoic acid
PubChem CID62201200
Molecular FormulaC15H24N2O3
Molecular Weight280.37 g/mol
Exact Mass280.18
IUPAC Name3-(1-hexan-2-yl-4,6-dimethyl-2-oxopyrimidin-5-yl)propanoic acid
SMILESCCCCC(C)n1c(C)c(CCC(=O)O)c(C)nc1=O
InChIInChI=1S/C15H24N2O3/c1-5-6-7-10(2)17-12(4)13(8-9-14(18)19)11(3)16-15(17)20/h10H,5-9H2,1-4H3,(H,18,19)
InChIKeyAYYFXWZUBJGJFZ-UHFFFAOYSA-N
XLogP2.63
TPSA72.19 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds7
Heavy Atoms20
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500280.37
LogP ≤ 52.63
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 3-(1-hexan-2-yl-4,6-dimethyl-2-oxopyrimidin-5-yl)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(1-hexan-2-yl-4,6-dimethyl-2-oxopyrimidin-5-yl)propanoic acid?
The IUPAC name of 3-(1-hexan-2-yl-4,6-dimethyl-2-oxopyrimidin-5-yl)propanoic acid (CID 62201200) is 3-(1-hexan-2-yl-4,6-dimethyl-2-oxopyrimidin-5-yl)propanoic acid.
What is the SMILES notation for 3-(1-hexan-2-yl-4,6-dimethyl-2-oxopyrimidin-5-yl)propanoic acid?
The canonical SMILES for 3-(1-hexan-2-yl-4,6-dimethyl-2-oxopyrimidin-5-yl)propanoic acid is CCCCC(C)n1c(C)c(CCC(=O)O)c(C)nc1=O.
What is the InChIKey of 3-(1-hexan-2-yl-4,6-dimethyl-2-oxopyrimidin-5-yl)propanoic acid?
The InChIKey is AYYFXWZUBJGJFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24N2O3/c1-5-6-7-10(2)17-12(4)13(8-9-14(18)19)11(3)16-15(17)20/h10H,5-9H2,1-4H3,(H,18,19).
What are the key properties of 3-(1-hexan-2-yl-4,6-dimethyl-2-oxopyrimidin-5-yl)propanoic acid?
3-(1-hexan-2-yl-4,6-dimethyl-2-oxopyrimidin-5-yl)propanoic acid has a molecular weight of 280.37 g/mol, XLogP of 2.63, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1-hexan-2-yl-4,6-dimethyl-2-oxopyrimidin-5-yl)propanoic acid is sourced from PubChem (CID 62201200), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).