C13H12F3N3 — CID 62201435
N-ethyl-6-[3-(trifluoromethyl)phenyl]pyridazin-3-amine (PubChem CID 62201435) has the molecular formula C13H12F3N3 and a molecular weight of 267.25 g/mol. Its IUPAC name is N-ethyl-6-[3-(trifluoromethyl)phenyl]pyridazin-3-amine.
| Compound Name | N-ethyl-6-[3-(trifluoromethyl)phenyl]pyridazin-3-amine |
|---|---|
| PubChem CID | 62201435 |
| Molecular Formula | C13H12F3N3 |
| Molecular Weight | 267.25 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | N-ethyl-6-[3-(trifluoromethyl)phenyl]pyridazin-3-amine |
| SMILES | CCNc1ccc(-c2cccc(C(F)(F)F)c2)nn1 |
| InChI | InChI=1S/C13H12F3N3/c1-2-17-12-7-6-11(18-19-12)9-4-3-5-10(8-9)13(14,15)16/h3-8H,2H2,1H3,(H,17,19) |
| InChIKey | PHWQUBOLXHJTGD-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.25 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |