C23H26N2O6 — CID 6220154
1-[2-(cyclohexen-1-yl)ethyl]-5-[(E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]-6-hydroxypyrimidine-2,4-dione (PubChem CID 6220154) has the molecular formula C23H26N2O6 and a molecular weight of 426.47 g/mol. Its IUPAC name is 1-[2-(cyclohexen-1-yl)ethyl]-5-[(E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]-6-hydroxypyrimidine-2,4-dione.
| Compound Name | 1-[2-(cyclohexen-1-yl)ethyl]-5-[(E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]-6-hydroxypyrimidine-2,4-dione |
|---|---|
| PubChem CID | 6220154 |
| Molecular Formula | C23H26N2O6 |
| Molecular Weight | 426.47 g/mol |
| Exact Mass | 426.18 |
| IUPAC Name | 1-[2-(cyclohexen-1-yl)ethyl]-5-[(E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]-6-hydroxypyrimidine-2,4-dione |
| SMILES | COc1ccc(/C=C/C(=O)c2c(O)n(CCC3=CCCCC3)c(=O)[nH]c2=O)cc1OC |
| InChI | InChI=1S/C23H26N2O6/c1-30-18-11-9-16(14-19(18)31-2)8-10-17(26)20-21(27)24-23(29)25(22(20)28)13-12-15-6-4-3-5-7-15/h6,8-11,14,28H,3-5,7,12-13H2,1-2H3,(H,24,27,29)/b10-8+ |
| InChIKey | PYBSSPMYRUPSBK-CSKARUKUSA-N |
| XLogP | 3.05 |
| TPSA | 110.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.47 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|