About 2-tert-butyl-6,8-dimethylquinolin-4-amine
2-tert-butyl-6,8-dimethylquinolin-4-amine (PubChem CID 62201635) has the molecular formula C15H20N2
and a molecular weight of 228.34 g/mol. Its IUPAC name is 2-tert-butyl-6,8-dimethylquinolin-4-amine.
Molecular Properties
| Compound Name | 2-tert-butyl-6,8-dimethylquinolin-4-amine |
| PubChem CID | 62201635 |
| Molecular Formula | C15H20N2 |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.16 |
| IUPAC Name | 2-tert-butyl-6,8-dimethylquinolin-4-amine |
| SMILES | Cc1cc(C)c2nc(C(C)(C)C)cc(N)c2c1 |
| InChI | InChI=1S/C15H20N2/c1-9-6-10(2)14-11(7-9)12(16)8-13(17-14)15(3,4)5/h6-8H,1-5H3,(H2,16,17) |
| InChIKey | PZDPRVBIHIPAAZ-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-tert-butyl-6,8-dimethylquinolin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butyl-6,8-dimethylquinolin-4-amine?
The IUPAC name of 2-tert-butyl-6,8-dimethylquinolin-4-amine (CID 62201635) is 2-tert-butyl-6,8-dimethylquinolin-4-amine.
What is the SMILES notation for 2-tert-butyl-6,8-dimethylquinolin-4-amine?
The canonical SMILES for 2-tert-butyl-6,8-dimethylquinolin-4-amine is Cc1cc(C)c2nc(C(C)(C)C)cc(N)c2c1.
What is the InChIKey of 2-tert-butyl-6,8-dimethylquinolin-4-amine?
The InChIKey is PZDPRVBIHIPAAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20N2/c1-9-6-10(2)14-11(7-9)12(16)8-13(17-14)15(3,4)5/h6-8H,1-5H3,(H2,16,17).
What are the key properties of 2-tert-butyl-6,8-dimethylquinolin-4-amine?
2-tert-butyl-6,8-dimethylquinolin-4-amine has a molecular weight of 228.34 g/mol, XLogP of 3.73, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butyl-6,8-dimethylquinolin-4-amine is sourced from PubChem (CID 62201635), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).