C15H19N3O2 — CID 62201725
2-(2,5-dimethoxyphenyl)-N,5,6-trimethylpyrimidin-4-amine (PubChem CID 62201725) has the molecular formula C15H19N3O2 and a molecular weight of 273.34 g/mol. Its IUPAC name is 2-(2,5-dimethoxyphenyl)-N,5,6-trimethylpyrimidin-4-amine.
| Compound Name | 2-(2,5-dimethoxyphenyl)-N,5,6-trimethylpyrimidin-4-amine |
|---|---|
| PubChem CID | 62201725 |
| Molecular Formula | C15H19N3O2 |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | 2-(2,5-dimethoxyphenyl)-N,5,6-trimethylpyrimidin-4-amine |
| SMILES | CNc1nc(-c2cc(OC)ccc2OC)nc(C)c1C |
| InChI | InChI=1S/C15H19N3O2/c1-9-10(2)17-15(18-14(9)16-3)12-8-11(19-4)6-7-13(12)20-5/h6-8H,1-5H3,(H,16,17,18) |
| InChIKey | BEFKEKFQROMVHA-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |