C17H17N3 — CID 62202615
2-naphthalen-2-yl-N-propylpyrimidin-4-amine (PubChem CID 62202615) has the molecular formula C17H17N3 and a molecular weight of 263.34 g/mol. Its IUPAC name is 2-naphthalen-2-yl-N-propylpyrimidin-4-amine.
| Compound Name | 2-naphthalen-2-yl-N-propylpyrimidin-4-amine |
|---|---|
| PubChem CID | 62202615 |
| Molecular Formula | C17H17N3 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.14 |
| IUPAC Name | 2-naphthalen-2-yl-N-propylpyrimidin-4-amine |
| SMILES | CCCNc1ccnc(-c2ccc3ccccc3c2)n1 |
| InChI | InChI=1S/C17H17N3/c1-2-10-18-16-9-11-19-17(20-16)15-8-7-13-5-3-4-6-14(13)12-15/h3-9,11-12H,2,10H2,1H3,(H,18,19,20) |
| InChIKey | XNEMHSQJOJUAJJ-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |