C12H11Br2N3O — CID 62202837
2-(4,5-dibromofuran-2-yl)-5,6,7,8-tetrahydroquinazolin-4-amine (PubChem CID 62202837) has the molecular formula C12H11Br2N3O and a molecular weight of 373.05 g/mol. Its IUPAC name is 2-(4,5-dibromofuran-2-yl)-5,6,7,8-tetrahydroquinazolin-4-amine.
| Compound Name | 2-(4,5-dibromofuran-2-yl)-5,6,7,8-tetrahydroquinazolin-4-amine |
|---|---|
| PubChem CID | 62202837 |
| Molecular Formula | C12H11Br2N3O |
| Molecular Weight | 373.05 g/mol |
| Exact Mass | 370.93 |
| IUPAC Name | 2-(4,5-dibromofuran-2-yl)-5,6,7,8-tetrahydroquinazolin-4-amine |
| SMILES | Nc1nc(-c2cc(Br)c(Br)o2)nc2c1CCCC2 |
| InChI | InChI=1S/C12H11Br2N3O/c13-7-5-9(18-10(7)14)12-16-8-4-2-1-3-6(8)11(15)17-12/h5H,1-4H2,(H2,15,16,17) |
| InChIKey | LNOPNDVTYGSDEG-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.05 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |